C19H19N3O4 — CID 166721840
1-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]but-3-enylcarbamic acid (PubChem CID 166721840) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]but-3-enylcarbamic acid.
| Compound Name | 1-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]but-3-enylcarbamic acid |
|---|---|
| PubChem CID | 166721840 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]but-3-enylcarbamic acid |
| SMILES | C=CCC(NC(=O)O)c1ncc(-c2cc3ccc(C)nc3cc2OC)o1 |
| InChI | InChI=1S/C19H19N3O4/c1-4-5-14(22-19(23)24)18-20-10-17(26-18)13-8-12-7-6-11(2)21-15(12)9-16(13)25-3/h4,6-10,14,22H,1,5H2,2-3H3,(H,23,24) |
| InChIKey | BWOQWAUYQILJEL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|