C14H19BrNO4S+ — CID 162508919
2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-bromo-2-phenylacetate (PubChem CID 162508919) has the molecular formula C14H19BrNO4S+ and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-bromo-2-phenylacetate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-bromo-2-phenylacetate |
|---|---|
| PubChem CID | 162508919 |
| Molecular Formula | C14H19BrNO4S+ |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-bromo-2-phenylacetate |
| SMILES | O=C(OCC[NH+]1CCS(=O)(=O)CC1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C14H18BrNO4S/c15-13(12-4-2-1-3-5-12)14(17)20-9-6-16-7-10-21(18,19)11-8-16/h1-5,13H,6-11H2/p+1 |
| InChIKey | JCSUPDDAPOXVLP-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|