C10H18NO4S+ — CID 155649878
2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-methylprop-2-enoate (PubChem CID 155649878) has the molecular formula C10H18NO4S+ and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155649878 |
| Molecular Formula | C10H18NO4S+ |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[NH+]1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H17NO4S/c1-9(2)10(12)15-6-3-11-4-7-16(13,14)8-5-11/h1,3-8H2,2H3/p+1 |
| InChIKey | SICOBILJPXPLRF-UHFFFAOYSA-O |
| XLogP | -1.58 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|