C8H15INO4S+ — CID 162508088
2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-iodoacetate (PubChem CID 162508088) has the molecular formula C8H15INO4S+ and a molecular weight of 348.18 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-iodoacetate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-iodoacetate |
|---|---|
| PubChem CID | 162508088 |
| Molecular Formula | C8H15INO4S+ |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 2-iodoacetate |
| SMILES | O=C(CI)OCC[NH+]1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H14INO4S/c9-7-8(11)14-4-1-10-2-5-15(12,13)6-3-10/h1-7H2/p+1 |
| InChIKey | UFJRFSDOBBOGFZ-UHFFFAOYSA-O |
| XLogP | -1.72 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|