About 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate
2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate (PubChem CID 162508673) has the molecular formula C9H17INO4S+
and a molecular weight of 362.21 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate |
| PubChem CID | 162508673 |
| Molecular Formula | C9H17INO4S+ |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate |
| SMILES | O=C(CCI)OCC[NH+]1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16INO4S/c10-2-1-9(12)15-6-3-11-4-7-16(13,14)8-5-11/h1-8H2/p+1 |
| InChIKey | DVOATMYNAYEKBE-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate?
The IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate (CID 162508673) is 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate.
What is the SMILES notation for 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate?
The canonical SMILES for 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate is O=C(CCI)OCC[NH+]1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate?
The InChIKey is DVOATMYNAYEKBE-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H16INO4S/c10-2-1-9(12)15-6-3-11-4-7-16(13,14)8-5-11/h1-8H2/p+1.
What are the key properties of 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate?
2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate has a molecular weight of 362.21 g/mol, XLogP of -1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)ethyl 3-iodopropanoate is sourced from PubChem (CID 162508673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).