About iodo 3-iodopropanoate
iodo 3-iodopropanoate (PubChem CID 57144880) has the molecular formula C3H4I2O2
and a molecular weight of 325.87 g/mol. Its IUPAC name is iodo 3-iodopropanoate.
Molecular Properties
| Compound Name | iodo 3-iodopropanoate |
| PubChem CID | 57144880 |
| Molecular Formula | C3H4I2O2 |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.83 |
| IUPAC Name | iodo 3-iodopropanoate |
| SMILES | O=C(CCI)OI |
| InChI | InChI=1S/C3H4I2O2/c4-2-1-3(6)7-5/h1-2H2 |
| InChIKey | DOBJVWVVEONGGH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo 3-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo 3-iodopropanoate?
The IUPAC name of iodo 3-iodopropanoate (CID 57144880) is iodo 3-iodopropanoate.
What is the SMILES notation for iodo 3-iodopropanoate?
The canonical SMILES for iodo 3-iodopropanoate is O=C(CCI)OI.
What is the InChIKey of iodo 3-iodopropanoate?
The InChIKey is DOBJVWVVEONGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4I2O2/c4-2-1-3(6)7-5/h1-2H2.
What are the key properties of iodo 3-iodopropanoate?
iodo 3-iodopropanoate has a molecular weight of 325.87 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodo 3-iodopropanoate is sourced from PubChem (CID 57144880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).