About lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate
lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate (PubChem CID 162510810) has the molecular formula C5H12LiO5S2-
and a molecular weight of 223.22 g/mol. Its IUPAC name is lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate.
Molecular Properties
| Compound Name | lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate |
| PubChem CID | 162510810 |
| Molecular Formula | C5H12LiO5S2- |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate |
| SMILES | O=S([O-])CCS(=O)(=O)CCO.[CH3-].[Li+] |
| InChI | InChI=1S/C4H10O5S2.CH3.Li/c5-1-3-11(8,9)4-2-10(6)7;;/h5H,1-4H2,(H,6,7);1H3;/q;-1;+1/p-1 |
| InChIKey | CCMSXWSZJLDYAL-UHFFFAOYSA-M |
| XLogP | -4.27 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate?
The IUPAC name of lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate (CID 162510810) is lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate.
What is the SMILES notation for lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate?
The canonical SMILES for lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate is O=S([O-])CCS(=O)(=O)CCO.[CH3-].[Li+].
What is the InChIKey of lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate?
The InChIKey is CCMSXWSZJLDYAL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O5S2.CH3.Li/c5-1-3-11(8,9)4-2-10(6)7;;/h5H,1-4H2,(H,6,7);1H3;/q;-1;+1/p-1.
What are the key properties of lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate?
lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate has a molecular weight of 223.22 g/mol, XLogP of -4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;carbanide;2-(2-hydroxyethylsulfonyl)ethanesulfinate is sourced from PubChem (CID 162510810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).