C32H46N3O12P — CID 162514704
tert-butyl 3-[bis[1-(phenylmethoxycarbonylamino)ethoxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 162514704) has the molecular formula C32H46N3O12P and a molecular weight of 695.70 g/mol. Its IUPAC name is tert-butyl 3-[bis[1-(phenylmethoxycarbonylamino)ethoxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl 3-[bis[1-(phenylmethoxycarbonylamino)ethoxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 162514704 |
| Molecular Formula | C32H46N3O12P |
| Molecular Weight | 695.70 g/mol |
| Exact Mass | 695.28 |
| IUPAC Name | tert-butyl 3-[bis[1-(phenylmethoxycarbonylamino)ethoxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OCc1ccccc1)OP(=O)(OCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OC(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H46N3O12P/c1-22(33-28(37)41-19-24-15-11-9-12-16-24)46-48(40,47-23(2)34-29(38)42-20-25-17-13-10-14-18-25)43-21-26(27(36)44-31(3,4)5)35-30(39)45-32(6,7)8/h9-18,22-23,26H,19-21H2,1-8H3,(H,33,37)(H,34,38)(H,35,39) |
| InChIKey | OMYOGUVEVRFPEH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 186.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|