C19H32IN5O4 — CID 162516544
tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate iodide (PubChem CID 162516544) has the molecular formula C19H32IN5O4 and a molecular weight of 521.40 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate iodide.
| Compound Name | tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate iodide |
|---|---|
| PubChem CID | 162516544 |
| Molecular Formula | C19H32IN5O4 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate iodide |
| SMILES | C[n+]1ccn(C(=O)N2CCCN(C(=O)C(C)(C)NC(=O)OC(C)(C)C)CC2)c1.[I-] |
| InChI | InChI=1S/C19H31N5O4.HI/c1-18(2,3)28-16(26)20-19(4,5)15(25)22-8-7-9-23(13-12-22)17(27)24-11-10-21(6)14-24;/h10-11,14H,7-9,12-13H2,1-6H3;1H |
| InChIKey | LEZOIRSFCPZOGL-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|