C14H21IN2O3 — CID 140733362
tert-butyl N-[1-[3-(2-iodoethynyl)azetidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate (PubChem CID 140733362) has the molecular formula C14H21IN2O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2-iodoethynyl)azetidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(2-iodoethynyl)azetidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 140733362 |
| Molecular Formula | C14H21IN2O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | tert-butyl N-[1-[3-(2-iodoethynyl)azetidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)N1CC(C#CI)C1 |
| InChI | InChI=1S/C14H21IN2O3/c1-13(2,3)20-12(19)16-14(4,5)11(18)17-8-10(9-17)6-7-15/h10H,8-9H2,1-5H3,(H,16,19) |
| InChIKey | BCRRCOSMTGTWFA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|