C18H30N5O4+ — CID 154651521
tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 154651521) has the molecular formula C18H30N5O4+ and a molecular weight of 380.47 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 154651521 |
| Molecular Formula | C18H30N5O4+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[4-(3-methylimidazol-3-ium-1-carbonyl)piperazin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[n+]1ccn(C(=O)N2CCN(C(=O)C(C)(C)NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C18H29N5O4/c1-17(2,3)27-15(25)19-18(4,5)14(24)21-9-11-22(12-10-21)16(26)23-8-7-20(6)13-23/h7-8,13H,9-12H2,1-6H3/p+1 |
| InChIKey | PREXYGFFUFJSPB-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|