C44H80O3Si — CID 162517813
[(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 162517813) has the molecular formula C44H80O3Si and a molecular weight of 685.21 g/mol. Its IUPAC name is [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 162517813 |
| Molecular Formula | C44H80O3Si |
| Molecular Weight | 685.21 g/mol |
| Exact Mass | 684.59 |
| IUPAC Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@@H](C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)CCCCCC |
| InChI | InChI=1S/C44H80O3Si/c1-8-10-12-14-15-16-17-18-19-20-21-22-23-26-29-32-36-40-43(45)47-42(38-34-13-11-9-2)39-35-31-28-25-24-27-30-33-37-41-46-48(6,7)44(3,4)5/h15-16,18-19,21-22,26,29,31,35,42H,8-14,17,20,23-25,27-28,30,32-34,36-41H2,1-7H3/b16-15-,19-18-,22-21-,29-26-,35-31-/t42-/m1/s1 |
| InChIKey | HYLHAJDIVMJZIE-HYCDNJFSSA-N |
| XLogP | 14.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.21 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|