C10H19IO5 — CID 162517826
(2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-ol (PubChem CID 162517826) has the molecular formula C10H19IO5 and a molecular weight of 346.16 g/mol. Its IUPAC name is (2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-ol.
| Compound Name | (2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-ol |
|---|---|
| PubChem CID | 162517826 |
| Molecular Formula | C10H19IO5 |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-ol |
| SMILES | C=C[C@@H](OCOC)[C@H](O)[C@@H](CI)OCOC |
| InChI | InChI=1S/C10H19IO5/c1-4-8(15-6-13-2)10(12)9(5-11)16-7-14-3/h4,8-10,12H,1,5-7H2,2-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | BSCCABMKILAGSY-BBBLOLIVSA-N |
| XLogP | 0.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|