C22H26N4O3S — CID 162519026
ethyl 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamothioylamino)-2-hydroxy-2-pyrazin-2-ylpropanoate (PubChem CID 162519026) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is ethyl 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamothioylamino)-2-hydroxy-2-pyrazin-2-ylpropanoate.
| Compound Name | ethyl 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamothioylamino)-2-hydroxy-2-pyrazin-2-ylpropanoate |
|---|---|
| PubChem CID | 162519026 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethyl 3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamothioylamino)-2-hydroxy-2-pyrazin-2-ylpropanoate |
| SMILES | CCOC(=O)C(O)(CNC(=S)Nc1c2c(cc3c1CCC3)CCC2)c1cnccn1 |
| InChI | InChI=1S/C22H26N4O3S/c1-2-29-20(27)22(28,18-12-23-9-10-24-18)13-25-21(30)26-19-16-7-3-5-14(16)11-15-6-4-8-17(15)19/h9-12,28H,2-8,13H2,1H3,(H2,25,26,30) |
| InChIKey | FNWVEFQOUPVDNQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|