C21H35NO3 — CID 162524658
1-(4-hydroxy-2-methylbutan-2-yl)pyrrole-2,5-dione;3,3,5,5,6-pentamethylhept-1-yne (PubChem CID 162524658) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylbutan-2-yl)pyrrole-2,5-dione;3,3,5,5,6-pentamethylhept-1-yne.
| Compound Name | 1-(4-hydroxy-2-methylbutan-2-yl)pyrrole-2,5-dione;3,3,5,5,6-pentamethylhept-1-yne |
|---|---|
| PubChem CID | 162524658 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 1-(4-hydroxy-2-methylbutan-2-yl)pyrrole-2,5-dione;3,3,5,5,6-pentamethylhept-1-yne |
| SMILES | C#CC(C)(C)CC(C)(C)C(C)C.CC(C)(CCO)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H22.C9H13NO3/c1-8-11(4,5)9-12(6,7)10(2)3;1-9(2,5-6-11)10-7(12)3-4-8(10)13/h1,10H,9H2,2-7H3;3-4,11H,5-6H2,1-2H3 |
| InChIKey | JSIMCDSWFQWNQG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|