C13H20N2O6S — CID 130281954
1-amino-5-(2,5-dioxopyrrol-1-yl)-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid (PubChem CID 130281954) has the molecular formula C13H20N2O6S and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-amino-5-(2,5-dioxopyrrol-1-yl)-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid.
| Compound Name | 1-amino-5-(2,5-dioxopyrrol-1-yl)-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid |
|---|---|
| PubChem CID | 130281954 |
| Molecular Formula | C13H20N2O6S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-amino-5-(2,5-dioxopyrrol-1-yl)-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid |
| SMILES | CC(C)(CC(C)(C)N1C(=O)C=CC1=O)C(C(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C13H20N2O6S/c1-12(2,10(11(14)18)22(19,20)21)7-13(3,4)15-8(16)5-6-9(15)17/h5-6,10H,7H2,1-4H3,(H2,14,18)(H,19,20,21) |
| InChIKey | UHJNEWRVSPBRKQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|