C26H31N3O5S — CID 162524848
[3-hydroxy-4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 162524848) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is [3-hydroxy-4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-hydroxy-4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162524848 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [3-hydroxy-4-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(-c3ccc(OC4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)cc1 |
| InChI | InChI=1S/C26H31N3O5S/c1-17-6-9-20(10-7-17)35(31,32)34-18-8-11-21(23(30)14-18)22-12-13-24(28-27-22)33-19-15-25(2,3)29-26(4,5)16-19/h6-14,19,29-30H,15-16H2,1-5H3 |
| InChIKey | NXFNJTJDYMSWCT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|