C25H42BrN3O2 — CID 162531698
tert-butyl 2-(6-bromo-2-pyridinyl)-6-[C-[(Z)-but-2-en-2-yl]-N-methylcarbonimidoyl]piperidine-1-carboxylate;ethane (PubChem CID 162531698) has the molecular formula C25H42BrN3O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is tert-butyl 2-(6-bromo-2-pyridinyl)-6-[C-[(Z)-but-2-en-2-yl]-N-methylcarbonimidoyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-(6-bromo-2-pyridinyl)-6-[C-[(Z)-but-2-en-2-yl]-N-methylcarbonimidoyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 162531698 |
| Molecular Formula | C25H42BrN3O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | tert-butyl 2-(6-bromo-2-pyridinyl)-6-[C-[(Z)-but-2-en-2-yl]-N-methylcarbonimidoyl]piperidine-1-carboxylate;ethane |
| SMILES | C/C=C(C)\C(=N/C)C1CCCC(c2cccc(Br)n2)N1C(=O)OC(C)(C)C.CC.CC |
| InChI | InChI=1S/C21H30BrN3O2.2C2H6/c1-7-14(2)19(23-6)17-12-9-11-16(15-10-8-13-18(22)24-15)25(17)20(26)27-21(3,4)5;2*1-2/h7-8,10,13,16-17H,9,11-12H2,1-6H3;2*1-2H3/b14-7-,23-19+;; |
| InChIKey | YEEAJQIOCMBJFF-SVHNYZQPSA-N |
| XLogP | 7.76 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|