C21H40N2O2 — CID 168886527
tert-butyl 4-[C-[(E)-but-2-en-2-yl]-N-methylcarbonimidoyl]azepane-1-carboxylate;ethane;ethene (PubChem CID 168886527) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is tert-butyl 4-[C-[(E)-but-2-en-2-yl]-N-methylcarbonimidoyl]azepane-1-carboxylate;ethane;ethene.
| Compound Name | tert-butyl 4-[C-[(E)-but-2-en-2-yl]-N-methylcarbonimidoyl]azepane-1-carboxylate;ethane;ethene |
|---|---|
| PubChem CID | 168886527 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | tert-butyl 4-[C-[(E)-but-2-en-2-yl]-N-methylcarbonimidoyl]azepane-1-carboxylate;ethane;ethene |
| SMILES | C/C=C(C)/C(=N\C)C1CCCN(C(=O)OC(C)(C)C)CC1.C=C.CC |
| InChI | InChI=1S/C17H30N2O2.C2H6.C2H4/c1-7-13(2)15(18-6)14-9-8-11-19(12-10-14)16(20)21-17(3,4)5;2*1-2/h7,14H,8-12H2,1-6H3;1-2H3;1-2H2/b13-7+,18-15+;; |
| InChIKey | RUDSTZUEFYCDQA-VOFWNJAZSA-N |
| XLogP | 5.89 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|