C11H9F4N — CID 162534917
3-fluoro-2-(4,4,4-trifluorobutyl)benzonitrile (PubChem CID 162534917) has the molecular formula C11H9F4N and a molecular weight of 231.19 g/mol. Its IUPAC name is 3-fluoro-2-(4,4,4-trifluorobutyl)benzonitrile.
| Compound Name | 3-fluoro-2-(4,4,4-trifluorobutyl)benzonitrile |
|---|---|
| PubChem CID | 162534917 |
| Molecular Formula | C11H9F4N |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-fluoro-2-(4,4,4-trifluorobutyl)benzonitrile |
| SMILES | N#Cc1cccc(F)c1CCCC(F)(F)F |
| InChI | InChI=1S/C11H9F4N/c12-10-5-1-3-8(7-16)9(10)4-2-6-11(13,14)15/h1,3,5H,2,4,6H2 |
| InChIKey | CGNDMMBJGIWNEX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |