C11H9Br2F3 — CID 162539063
[4,4-dibromo-3-(trifluoromethyl)but-3-enyl]benzene (PubChem CID 162539063) has the molecular formula C11H9Br2F3 and a molecular weight of 358.00 g/mol. Its IUPAC name is [4,4-dibromo-3-(trifluoromethyl)but-3-enyl]benzene.
| Compound Name | [4,4-dibromo-3-(trifluoromethyl)but-3-enyl]benzene |
|---|---|
| PubChem CID | 162539063 |
| Molecular Formula | C11H9Br2F3 |
| Molecular Weight | 358.00 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | [4,4-dibromo-3-(trifluoromethyl)but-3-enyl]benzene |
| SMILES | FC(F)(F)C(CCc1ccccc1)=C(Br)Br |
| InChI | InChI=1S/C11H9Br2F3/c12-10(13)9(11(14,15)16)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | FYFRHRPTTFIPEJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |