About (4-bromo-5,5-difluoropent-4-enyl)benzene
(4-bromo-5,5-difluoropent-4-enyl)benzene (PubChem CID 175870793) has the molecular formula C11H11BrF2
and a molecular weight of 261.11 g/mol. Its IUPAC name is (4-bromo-5,5-difluoropent-4-enyl)benzene.
Molecular Properties
| Compound Name | (4-bromo-5,5-difluoropent-4-enyl)benzene |
| PubChem CID | 175870793 |
| Molecular Formula | C11H11BrF2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (4-bromo-5,5-difluoropent-4-enyl)benzene |
| SMILES | FC(F)=C(Br)CCCc1ccccc1 |
| InChI | InChI=1S/C11H11BrF2/c12-10(11(13)14)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | YPJAXPHJJKAAFO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4-bromo-5,5-difluoropent-4-enyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-5,5-difluoropent-4-enyl)benzene?
The IUPAC name of (4-bromo-5,5-difluoropent-4-enyl)benzene (CID 175870793) is (4-bromo-5,5-difluoropent-4-enyl)benzene.
What is the SMILES notation for (4-bromo-5,5-difluoropent-4-enyl)benzene?
The canonical SMILES for (4-bromo-5,5-difluoropent-4-enyl)benzene is FC(F)=C(Br)CCCc1ccccc1.
What is the InChIKey of (4-bromo-5,5-difluoropent-4-enyl)benzene?
The InChIKey is YPJAXPHJJKAAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2/c12-10(11(13)14)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2.
What are the key properties of (4-bromo-5,5-difluoropent-4-enyl)benzene?
(4-bromo-5,5-difluoropent-4-enyl)benzene has a molecular weight of 261.11 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-5,5-difluoropent-4-enyl)benzene is sourced from PubChem (CID 175870793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).