C17H22F2O — CID 162547328
3-[2-(4-butylphenyl)ethyl]-6,6-difluoro-2,5-dihydropyran (PubChem CID 162547328) has the molecular formula C17H22F2O and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-[2-(4-butylphenyl)ethyl]-6,6-difluoro-2,5-dihydropyran.
| Compound Name | 3-[2-(4-butylphenyl)ethyl]-6,6-difluoro-2,5-dihydropyran |
|---|---|
| PubChem CID | 162547328 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-[2-(4-butylphenyl)ethyl]-6,6-difluoro-2,5-dihydropyran |
| SMILES | CCCCc1ccc(CCC2=CCC(F)(F)OC2)cc1 |
| InChI | InChI=1S/C17H22F2O/c1-2-3-4-14-5-7-15(8-6-14)9-10-16-11-12-17(18,19)20-13-16/h5-8,11H,2-4,9-10,12-13H2,1H3 |
| InChIKey | GEVASZPOCRCMAR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|