C14H22F3N3O2 — CID 162548667
1-N-[[2-amino-5-(trifluoromethoxy)phenyl]methoxymethyl]-1-N',1-N'-dimethylpropane-1,1-diamine (PubChem CID 162548667) has the molecular formula C14H22F3N3O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-N-[[2-amino-5-(trifluoromethoxy)phenyl]methoxymethyl]-1-N',1-N'-dimethylpropane-1,1-diamine.
| Compound Name | 1-N-[[2-amino-5-(trifluoromethoxy)phenyl]methoxymethyl]-1-N',1-N'-dimethylpropane-1,1-diamine |
|---|---|
| PubChem CID | 162548667 |
| Molecular Formula | C14H22F3N3O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-N-[[2-amino-5-(trifluoromethoxy)phenyl]methoxymethyl]-1-N',1-N'-dimethylpropane-1,1-diamine |
| SMILES | CCC(NCOCc1cc(OC(F)(F)F)ccc1N)N(C)C |
| InChI | InChI=1S/C14H22F3N3O2/c1-4-13(20(2)3)19-9-21-8-10-7-11(5-6-12(10)18)22-14(15,16)17/h5-7,13,19H,4,8-9,18H2,1-3H3 |
| InChIKey | HLSCMTHUYIXMAW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|