C51H50BF9 — CID 162554062
[2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]-bis[2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)phenyl]phenyl]borane (PubChem CID 162554062) has the molecular formula C51H50BF9 and a molecular weight of 844.75 g/mol. Its IUPAC name is [2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]-bis[2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)phenyl]phenyl]borane.
| Compound Name | [2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]-bis[2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)phenyl]phenyl]borane |
|---|---|
| PubChem CID | 162554062 |
| Molecular Formula | C51H50BF9 |
| Molecular Weight | 844.75 g/mol |
| Exact Mass | 844.39 |
| IUPAC Name | [2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]phenyl]-bis[2,3,5,6-tetramethyl-4-[4-(trifluoromethyl)phenyl]phenyl]borane |
| SMILES | Cc1c(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c(C)c1B(c1c(C)c(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c1C)c1c(C)c(C)c(C2C=CC(C(F)(F)F)=CC2)c(C)c1C |
| InChI | InChI=1S/C51H50BF9/c1-25-31(7)46(32(8)26(2)43(25)37-13-19-40(20-14-37)49(53,54)55)52(47-33(9)27(3)44(28(4)34(47)10)38-15-21-41(22-16-38)50(56,57)58)48-35(11)29(5)45(30(6)36(48)12)39-17-23-42(24-18-39)51(59,60)61/h13-17,19-24,39H,18H2,1-12H3 |
| InChIKey | ROJFXMRMFNAFPH-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.75 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|