C22H19F6IN2O3 — CID 162555417
[1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-3-(4-phenylpiperazin-1-yl)propyl] carboniodidate (PubChem CID 162555417) has the molecular formula C22H19F6IN2O3 and a molecular weight of 600.30 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-3-(4-phenylpiperazin-1-yl)propyl] carboniodidate.
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-3-(4-phenylpiperazin-1-yl)propyl] carboniodidate |
|---|---|
| PubChem CID | 162555417 |
| Molecular Formula | C22H19F6IN2O3 |
| Molecular Weight | 600.30 g/mol |
| Exact Mass | 600.03 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-3-(4-phenylpiperazin-1-yl)propyl] carboniodidate |
| SMILES | O=C(I)OC(CC(=O)N1CCN(c2ccccc2)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F6IN2O3/c23-21(24,25)15-10-14(11-16(12-15)22(26,27)28)18(34-20(29)33)13-19(32)31-8-6-30(7-9-31)17-4-2-1-3-5-17/h1-5,10-12,18H,6-9,13H2 |
| InChIKey | MMDUXVXCDGQJPM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|