C24H27F3N4O3 — CID 41244842
N'-[(3S)-3-methyl-5-oxo-5-(4-phenylpiperazin-1-yl)pentanoyl]-4-(trifluoromethyl)benzohydrazide (PubChem CID 41244842) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is N'-[(3S)-3-methyl-5-oxo-5-(4-phenylpiperazin-1-yl)pentanoyl]-4-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[(3S)-3-methyl-5-oxo-5-(4-phenylpiperazin-1-yl)pentanoyl]-4-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 41244842 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N'-[(3S)-3-methyl-5-oxo-5-(4-phenylpiperazin-1-yl)pentanoyl]-4-(trifluoromethyl)benzohydrazide |
| SMILES | C[C@H](CC(=O)NNC(=O)c1ccc(C(F)(F)F)cc1)CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27F3N4O3/c1-17(16-22(33)31-13-11-30(12-14-31)20-5-3-2-4-6-20)15-21(32)28-29-23(34)18-7-9-19(10-8-18)24(25,26)27/h2-10,17H,11-16H2,1H3,(H,28,32)(H,29,34)/t17-/m1/s1 |
| InChIKey | YGBJMCOVIQGKOT-QGZVFWFLSA-N |
| XLogP | 3.23 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|