C28H32F3N3O5S2 — CID 162558777
[4-[2-(2,5-dimethylphenyl)sulfanyl-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4,6-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]methanone (PubChem CID 162558777) has the molecular formula C28H32F3N3O5S2 and a molecular weight of 611.71 g/mol. Its IUPAC name is [4-[2-(2,5-dimethylphenyl)sulfanyl-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4,6-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]methanone.
| Compound Name | [4-[2-(2,5-dimethylphenyl)sulfanyl-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4,6-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]methanone |
|---|---|
| PubChem CID | 162558777 |
| Molecular Formula | C28H32F3N3O5S2 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | [4-[2-(2,5-dimethylphenyl)sulfanyl-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4,6-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]methanone |
| SMILES | Cc1ccc(C)c(Sc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCN(C(=O)C3C=CC(C)(C(F)(F)F)CC3C)CC2)c1 |
| InChI | InChI=1S/C28H32F3N3O5S2/c1-18-5-6-19(2)24(15-18)40-23-8-7-21(34(36)37)16-25(23)41(38,39)33-13-11-32(12-14-33)26(35)22-9-10-27(4,17-20(22)3)28(29,30)31/h5-10,15-16,20,22H,11-14,17H2,1-4H3 |
| InChIKey | BNJAXJZJWMVGQX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|