C17H13F3N4O3 — CID 162563413
4-ethenyl-8-hydroxy-5-[[2-(trifluoromethoxy)phenyl]methylamino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 162563413) has the molecular formula C17H13F3N4O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-ethenyl-8-hydroxy-5-[[2-(trifluoromethoxy)phenyl]methylamino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-ethenyl-8-hydroxy-5-[[2-(trifluoromethoxy)phenyl]methylamino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 162563413 |
| Molecular Formula | C17H13F3N4O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-ethenyl-8-hydroxy-5-[[2-(trifluoromethoxy)phenyl]methylamino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=Cc1ncnc2c1c(NCc1ccccc1OC(F)(F)F)cc(=O)n2O |
| InChI | InChI=1S/C17H13F3N4O3/c1-2-11-15-12(7-14(25)24(26)16(15)23-9-22-11)21-8-10-5-3-4-6-13(10)27-17(18,19)20/h2-7,9,21,26H,1,8H2 |
| InChIKey | IXYCOGUGRGGECY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|