C23H20F3N3O4 — CID 162570024
N-[[(2S)-2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-inden-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 162570024) has the molecular formula C23H20F3N3O4 and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[[(2S)-2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-inden-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[[(2S)-2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-inden-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162570024 |
| Molecular Formula | C23H20F3N3O4 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[[(2S)-2-(2,6-dioxopiperidin-3-yl)-2-methyl-1-oxo-3H-inden-5-yl]methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C[C@@]1(C2CCC(=O)NC2=O)Cc2cc(CNC(=O)c3ccc(C(F)(F)F)nc3)ccc2C1=O |
| InChI | InChI=1S/C23H20F3N3O4/c1-22(16-5-7-18(30)29-21(16)33)9-14-8-12(2-4-15(14)19(22)31)10-28-20(32)13-3-6-17(27-11-13)23(24,25)26/h2-4,6,8,11,16H,5,7,9-10H2,1H3,(H,28,32)(H,29,30,33)/t16?,22-/m0/s1 |
| InChIKey | UJBOSMMXAWUBTM-XLDIYJRPSA-N |
| XLogP | 2.83 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|