C12H17F2N — CID 162575837
(2Z)-N-(3,3-difluoroprop-1-en-2-yl)-4-methyl-2-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 162575837) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is (2Z)-N-(3,3-difluoroprop-1-en-2-yl)-4-methyl-2-propan-2-ylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-(3,3-difluoroprop-1-en-2-yl)-4-methyl-2-propan-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 162575837 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (2Z)-N-(3,3-difluoroprop-1-en-2-yl)-4-methyl-2-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C=C(\C=N\C(=C)C(F)F)C(C)C |
| InChI | InChI=1S/C12H17F2N/c1-8(2)6-11(9(3)4)7-15-10(5)12(13)14/h6-7,9,12H,1,5H2,2-4H3/b11-6+,15-7+ |
| InChIKey | JFCUWJBEZJXTIG-WURNTEHJSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|