C24H29F2N7 — CID 162576269
N'-[N-butyl-C-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbonimidoyl]-2,2-difluoropentanimidamide (PubChem CID 162576269) has the molecular formula C24H29F2N7 and a molecular weight of 453.54 g/mol. Its IUPAC name is N'-[N-butyl-C-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbonimidoyl]-2,2-difluoropentanimidamide.
| Compound Name | N'-[N-butyl-C-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbonimidoyl]-2,2-difluoropentanimidamide |
|---|---|
| PubChem CID | 162576269 |
| Molecular Formula | C24H29F2N7 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N'-[N-butyl-C-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbonimidoyl]-2,2-difluoropentanimidamide |
| SMILES | CCCC/N=C(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)\N=C(/N)C(F)(F)CCC |
| InChI | InChI=1S/C24H29F2N7/c1-3-5-15-28-21(29-23(27)24(25,26)14-4-2)16-17-10-12-18(13-11-17)19-8-6-7-9-20(19)22-30-32-33-31-22/h6-13H,3-5,14-16H2,1-2H3,(H2,27,28,29)(H,30,31,32,33) |
| InChIKey | PAFBWEDUMGPODX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|