C18H20F4N6O2S — CID 162576433
7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-5-hydrazinyl-4-hydroxy-2-sulfanylidene-8-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 162576433) has the molecular formula C18H20F4N6O2S and a molecular weight of 460.46 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-5-hydrazinyl-4-hydroxy-2-sulfanylidene-8-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-5-hydrazinyl-4-hydroxy-2-sulfanylidene-8-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 162576433 |
| Molecular Formula | C18H20F4N6O2S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-5-hydrazinyl-4-hydroxy-2-sulfanylidene-8-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | NNc1c(F)c(N2CCC(N)C2)c(C(F)(F)F)c2c1c(O)c(C(N)=O)c(=S)n2C1CC1 |
| InChI | InChI=1S/C18H20F4N6O2S/c19-11-12(26-25)8-13(10(18(20,21)22)14(11)27-4-3-6(23)5-27)28(7-1-2-7)17(31)9(15(8)29)16(24)30/h6-7,26,29H,1-5,23,25H2,(H2,24,30) |
| InChIKey | MOSXNKIGMOANRF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|