C40H40F6N4O4 — CID 162576822
N-[5-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]pentyl]-2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanediamide (PubChem CID 162576822) has the molecular formula C40H40F6N4O4 and a molecular weight of 754.77 g/mol. Its IUPAC name is N-[5-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]pentyl]-2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanediamide.
| Compound Name | N-[5-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]pentyl]-2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 162576822 |
| Molecular Formula | C40H40F6N4O4 |
| Molecular Weight | 754.77 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | N-[5-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]pentyl]-2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanediamide |
| SMILES | NC(=O)CCC(NC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1)C(=O)NCCCCCC1(C(O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H40F6N4O4/c41-39(42,43)24-49-37(54)38(31-14-6-4-11-28(31)29-12-5-7-15-32(29)38)22-8-1-9-23-48-36(53)33(20-21-34(47)51)50-35(52)30-13-3-2-10-27(30)25-16-18-26(19-17-25)40(44,45)46/h2-7,10-19,33,37,49,54H,1,8-9,20-24H2,(H2,47,51)(H,48,53)(H,50,52) |
| InChIKey | IPZWPKHFZMMDNE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|