C26H29F3N4O3S — CID 162580501
4-[4-[hydroxy-[2-[4-(trifluoromethoxy)phenyl]anilino]methyl]-1,3-thiazol-2-yl]-N-propylpiperidine-1-carboxamide (PubChem CID 162580501) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is 4-[4-[hydroxy-[2-[4-(trifluoromethoxy)phenyl]anilino]methyl]-1,3-thiazol-2-yl]-N-propylpiperidine-1-carboxamide.
| Compound Name | 4-[4-[hydroxy-[2-[4-(trifluoromethoxy)phenyl]anilino]methyl]-1,3-thiazol-2-yl]-N-propylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 162580501 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 4-[4-[hydroxy-[2-[4-(trifluoromethoxy)phenyl]anilino]methyl]-1,3-thiazol-2-yl]-N-propylpiperidine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCC(c2nc(C(O)Nc3ccccc3-c3ccc(OC(F)(F)F)cc3)cs2)CC1 |
| InChI | InChI=1S/C26H29F3N4O3S/c1-2-13-30-25(35)33-14-11-18(12-15-33)24-32-22(16-37-24)23(34)31-21-6-4-3-5-20(21)17-7-9-19(10-8-17)36-26(27,28)29/h3-10,16,18,23,31,34H,2,11-15H2,1H3,(H,30,35) |
| InChIKey | FNEYNWAAGFHDJS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|