C18H16F3NO3S — CID 162582780
4-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]cyclohexan-1-one (PubChem CID 162582780) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is 4-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]cyclohexan-1-one.
| Compound Name | 4-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 162582780 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]cyclohexan-1-one |
| SMILES | O=C1CCC(c2ccccc2)(S(=O)(=O)c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C18H16F3NO3S/c19-18(20,21)16-7-6-15(12-22-16)26(24,25)17(10-8-14(23)9-11-17)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | ZEOBSHRNVRTJPS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |