C22H21F7N6OS — CID 162589522
(5S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexan-6-ol (PubChem CID 162589522) has the molecular formula C22H21F7N6OS and a molecular weight of 550.50 g/mol. Its IUPAC name is (5S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexan-6-ol.
| Compound Name | (5S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexan-6-ol |
|---|---|
| PubChem CID | 162589522 |
| Molecular Formula | C22H21F7N6OS |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | (5S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]bicyclo[3.1.0]hexan-6-ol |
| SMILES | Cc1nc(NCC(F)(F)C(F)(F)C(F)(F)F)nc(NC2CC3C(O)[C@H]3C2)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C22H21F7N6OS/c1-8-14(18-34-15-9(2)30-4-3-13(15)37-18)17(33-10-5-11-12(6-10)16(11)36)35-19(32-8)31-7-20(23,24)21(25,26)22(27,28)29/h3-4,10-12,16,36H,5-7H2,1-2H3,(H2,31,32,33,35)/t10?,11-,12?,16?/m0/s1 |
| InChIKey | BTGQHAGLDQJFCI-VUDCPIFDSA-N |
| XLogP | 5.19 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|