C16H23F3N6 — CID 162589988
2-[[1-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 162589988) has the molecular formula C16H23F3N6 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[[1-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[1-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 162589988 |
| Molecular Formula | C16H23F3N6 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-[[1-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C/C(=C\C=C(/C)C(F)(F)F)n1nnnc1CN1CCN2CCCC2C1 |
| InChI | InChI=1S/C16H23F3N6/c1-12(16(17,18)19)5-6-13(2)25-15(20-21-22-25)11-23-8-9-24-7-3-4-14(24)10-23/h5-6,14H,3-4,7-11H2,1-2H3/b12-5+,13-6+ |
| InChIKey | AEDSIAOSCGSNFL-BYDSPXIWSA-N |
| XLogP | 2.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|