C14H21F3N2O — CID 162591735
(1R)-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-3-ethanimidoylcyclohexane-1-carboxamide (PubChem CID 162591735) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is (1R)-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-3-ethanimidoylcyclohexane-1-carboxamide.
| Compound Name | (1R)-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-3-ethanimidoylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 162591735 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (1R)-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-3-ethanimidoylcyclohexane-1-carboxamide |
| SMILES | [H]/N=C(\C)C1CCC[C@@H](C(=O)N[C@H](C2CC2)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H21F3N2O/c1-8(18)10-3-2-4-11(7-10)13(20)19-12(9-5-6-9)14(15,16)17/h9-12,18H,2-7H2,1H3,(H,19,20)/b18-8+/t10?,11-,12-/m1/s1 |
| InChIKey | TZDDFYPLZWMSIU-PHMWPQAQSA-N |
| XLogP | 3.29 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|