C11H11F3O2 — CID 162604448
(E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-ene-2,2-diol (PubChem CID 162604448) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-ene-2,2-diol.
| Compound Name | (E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-ene-2,2-diol |
|---|---|
| PubChem CID | 162604448 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-ene-2,2-diol |
| SMILES | C/C(=C\c1ccccc1)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-8(10(15,16)11(12,13)14)7-9-5-3-2-4-6-9/h2-7,15-16H,1H3/b8-7+ |
| InChIKey | UXZQSZDKNCXUTO-BQYQJAHWSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|