C15H18B2F2O2 — CID 162607291
CID 162607291 (PubChem CID 162607291) has the molecular formula C15H18B2F2O2 and a molecular weight of 289.93 g/mol.
| Compound Name | CID 162607291 |
|---|---|
| PubChem CID | 162607291 |
| Molecular Formula | C15H18B2F2O2 |
| Molecular Weight | 289.93 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(CB2OC(C)(C)C(C)(C)O2)=C(F)F)cc1 |
| InChI | InChI=1S/C15H18B2F2O2/c1-14(2)15(3,4)21-17(20-14)9-12(13(18)19)10-5-7-11(16)8-6-10/h5-8H,9H2,1-4H3 |
| InChIKey | VAMVHDRMXBDFCX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|