C22H34F3N5O3 — CID 162608375
methyl 2-(6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 162608375) has the molecular formula C22H34F3N5O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is methyl 2-(6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | methyl 2-(6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 162608375 |
| Molecular Formula | C22H34F3N5O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | methyl 2-(6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)C(F)(F)F)N1CCN(C)CCN(C)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C22H34F3N5O3/c1-28-11-12-29(2)15-17-7-6-8-18(27-17)16-30(14-13-28)19(20(31)33-3)9-4-5-10-26-21(32)22(23,24)25/h6-8,19H,4-5,9-16H2,1-3H3,(H,26,32) |
| InChIKey | FOSMVBOVEGTKEY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|