C27H28F4N4O — CID 162614693
(2R,3S)-2-ethyl-3-[2-(6-fluoroquinolin-4-yl)oxyethyl]-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]hexan-1-imine (PubChem CID 162614693) has the molecular formula C27H28F4N4O and a molecular weight of 500.54 g/mol. Its IUPAC name is (2R,3S)-2-ethyl-3-[2-(6-fluoroquinolin-4-yl)oxyethyl]-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]hexan-1-imine.
| Compound Name | (2R,3S)-2-ethyl-3-[2-(6-fluoroquinolin-4-yl)oxyethyl]-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]hexan-1-imine |
|---|---|
| PubChem CID | 162614693 |
| Molecular Formula | C27H28F4N4O |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (2R,3S)-2-ethyl-3-[2-(6-fluoroquinolin-4-yl)oxyethyl]-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]hexan-1-imine |
| SMILES | [H]/N=C/[C@H](CC)[C@H](CCOc1ccnc2ccc(F)cc12)CC(C)c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C27H28F4N4O/c1-3-17(15-32)18(9-11-36-25-8-10-33-22-7-5-20(28)14-21(22)25)12-16(2)26-34-23-6-4-19(27(29,30)31)13-24(23)35-26/h4-8,10,13-18,32H,3,9,11-12H2,1-2H3,(H,34,35)/b32-15+/t16?,17-,18+/m0/s1 |
| InChIKey | SLCIIASQOIZTRO-ZYZRDKBLSA-N |
| XLogP | 7.52 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|