C16H14F3N3O2S — CID 57111534
(3,4-dimethoxy-2-pyridinyl)-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanethiol (PubChem CID 57111534) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is (3,4-dimethoxy-2-pyridinyl)-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanethiol.
| Compound Name | (3,4-dimethoxy-2-pyridinyl)-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 57111534 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (3,4-dimethoxy-2-pyridinyl)-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanethiol |
| SMILES | COc1ccnc(C(S)c2nc3ccc(C(F)(F)F)cc3[nH]2)c1OC |
| InChI | InChI=1S/C16H14F3N3O2S/c1-23-11-5-6-20-12(13(11)24-2)14(25)15-21-9-4-3-8(16(17,18)19)7-10(9)22-15/h3-7,14,25H,1-2H3,(H,21,22) |
| InChIKey | IETGFVYDYNEBPC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|