C21H29F3O — CID 162616900
(6Z,9Z,12Z)-1,1,1-trifluorohenicosa-6,9,12,15,16-pentaen-2-one (PubChem CID 162616900) has the molecular formula C21H29F3O and a molecular weight of 354.46 g/mol. Its IUPAC name is (6Z,9Z,12Z)-1,1,1-trifluorohenicosa-6,9,12,15,16-pentaen-2-one.
| Compound Name | (6Z,9Z,12Z)-1,1,1-trifluorohenicosa-6,9,12,15,16-pentaen-2-one |
|---|---|
| PubChem CID | 162616900 |
| Molecular Formula | C21H29F3O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (6Z,9Z,12Z)-1,1,1-trifluorohenicosa-6,9,12,15,16-pentaen-2-one |
| SMILES | CCCCC=C=CC/C=C\C/C=C\C/C=C\CCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(25)21(22,23)24/h5,7,9-10,12-13,15-16H,2-4,8,11,14,17-19H2,1H3/b10-9-,13-12-,16-15- |
| InChIKey | BLKGFYYRCHYTNX-YOILPLPUSA-N |
| XLogP | 7.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|