C16H14F8N8O — CID 162617532
N-cyclopropyl-2-hydrazinylidene-3-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]iminopropanamide (PubChem CID 162617532) has the molecular formula C16H14F8N8O and a molecular weight of 486.33 g/mol. Its IUPAC name is N-cyclopropyl-2-hydrazinylidene-3-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]iminopropanamide.
| Compound Name | N-cyclopropyl-2-hydrazinylidene-3-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]iminopropanamide |
|---|---|
| PubChem CID | 162617532 |
| Molecular Formula | C16H14F8N8O |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-cyclopropyl-2-hydrazinylidene-3-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]iminopropanamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(/N=C/C(=NN)C(=O)NC2CC2)cn1 |
| InChI | InChI=1S/C16H14F8N8O/c1-31-13(10(15(19,20)21)11(30-31)14(17,18)16(22,23)24)32-6-8(4-27-32)26-5-9(29-25)12(33)28-7-2-3-7/h4-7H,2-3,25H2,1H3,(H,28,33)/b26-5+,29-9? |
| InChIKey | VLEPQLSGPKXSEZ-YOTRPLPHSA-N |
| XLogP | 2.57 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|