C11H12F9N — CID 162620220
1-[1,2-difluoro-2-(trifluoromethyl)but-3-enyl]-2-fluoro-2-(trifluoromethyl)piperidine (PubChem CID 162620220) has the molecular formula C11H12F9N and a molecular weight of 329.21 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-(trifluoromethyl)but-3-enyl]-2-fluoro-2-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,2-difluoro-2-(trifluoromethyl)but-3-enyl]-2-fluoro-2-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 162620220 |
| Molecular Formula | C11H12F9N |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[1,2-difluoro-2-(trifluoromethyl)but-3-enyl]-2-fluoro-2-(trifluoromethyl)piperidine |
| SMILES | C=CC(F)(C(F)N1CCCCC1(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F9N/c1-2-8(13,10(15,16)17)7(12)21-6-4-3-5-9(21,14)11(18,19)20/h2,7H,1,3-6H2 |
| InChIKey | PRAMCSXGZABJQS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|