C11H22N2Si — CID 173096258
1,1-dipyrrolidin-1-ylprop-2-enylsilane (PubChem CID 173096258) has the molecular formula C11H22N2Si and a molecular weight of 210.40 g/mol. Its IUPAC name is 1,1-dipyrrolidin-1-ylprop-2-enylsilane.
| Compound Name | 1,1-dipyrrolidin-1-ylprop-2-enylsilane |
|---|---|
| PubChem CID | 173096258 |
| Molecular Formula | C11H22N2Si |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1,1-dipyrrolidin-1-ylprop-2-enylsilane |
| SMILES | C=CC([SiH3])(N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C11H22N2Si/c1-2-11(14,12-7-3-4-8-12)13-9-5-6-10-13/h2H,1,3-10H2,14H3 |
| InChIKey | YSWKKZUZDUWAMB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|