C13H20N2S — CID 175145180
1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid (PubChem CID 175145180) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid.
| Compound Name | 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid |
|---|---|
| PubChem CID | 175145180 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid |
| SMILES | C=CCC(C=C)(C=C)N1CCCC1.N#CS |
| InChI | InChI=1S/C12H19N.CHNS/c1-4-9-12(5-2,6-3)13-10-7-8-11-13;2-1-3/h4-6H,1-3,7-11H2;3H |
| InChIKey | ZNPOBPMTFLXLSD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|