1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid

C13H20N2S — CID 175145180

IUPAC1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid
SMILESC=CCC(C=C)(C=C)N1CCCC1.N#CS
InChIInChI=1S/C12H19N.CHNS/c1-4-9-12(5-2,6-3)13-10-7-8-11-13;2-1-3/h4-6H,1-3,7-11H2;3H
InChIKeyZNPOBPMTFLXLSD-UHFFFAOYSA-N
MW236.38 g/mol
LogP3.17
Rot. Bonds5

About 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid

1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid (PubChem CID 175145180) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid.

Molecular Properties

Compound Name1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid
PubChem CID175145180
Molecular FormulaC13H20N2S
Molecular Weight236.38 g/mol
Exact Mass236.13
IUPAC Name1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid
SMILESC=CCC(C=C)(C=C)N1CCCC1.N#CS
InChIInChI=1S/C12H19N.CHNS/c1-4-9-12(5-2,6-3)13-10-7-8-11-13;2-1-3/h4-6H,1-3,7-11H2;3H
InChIKeyZNPOBPMTFLXLSD-UHFFFAOYSA-N
XLogP3.17
TPSA27.03 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.38
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid?
The IUPAC name of 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid (CID 175145180) is 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid.
What is the SMILES notation for 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid?
The canonical SMILES for 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid is C=CCC(C=C)(C=C)N1CCCC1.N#CS.
What is the InChIKey of 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid?
The InChIKey is ZNPOBPMTFLXLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N.CHNS/c1-4-9-12(5-2,6-3)13-10-7-8-11-13;2-1-3/h4-6H,1-3,7-11H2;3H.
What are the key properties of 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid?
1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid has a molecular weight of 236.38 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethenylhexa-1,5-dien-3-yl)pyrrolidine;thiocyanic acid is sourced from PubChem (CID 175145180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).