C13H26N2Si — CID 173096266
1,1-di(piperidin-1-yl)prop-2-enylsilane (PubChem CID 173096266) has the molecular formula C13H26N2Si and a molecular weight of 238.45 g/mol. Its IUPAC name is 1,1-di(piperidin-1-yl)prop-2-enylsilane.
| Compound Name | 1,1-di(piperidin-1-yl)prop-2-enylsilane |
|---|---|
| PubChem CID | 173096266 |
| Molecular Formula | C13H26N2Si |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1,1-di(piperidin-1-yl)prop-2-enylsilane |
| SMILES | C=CC([SiH3])(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C13H26N2Si/c1-2-13(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h2H,1,3-12H2,16H3 |
| InChIKey | YZJSBRSGOXVRQB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|